C16H23FN2O4 — CID 142974608
tert-butyl N-[(2S)-1-(2-fluoro-4-methylanilino)-4-hydroxy-1-oxobutan-2-yl]carbamate (PubChem CID 142974608) has the molecular formula C16H23FN2O4 and a molecular weight of 326.37 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-fluoro-4-methylanilino)-4-hydroxy-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-fluoro-4-methylanilino)-4-hydroxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142974608 |
| Molecular Formula | C16H23FN2O4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-fluoro-4-methylanilino)-4-hydroxy-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1ccc(NC(=O)[C@H](CCO)NC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C16H23FN2O4/c1-10-5-6-12(11(17)9-10)18-14(21)13(7-8-20)19-15(22)23-16(2,3)4/h5-6,9,13,20H,7-8H2,1-4H3,(H,18,21)(H,19,22)/t13-/m0/s1 |
| InChIKey | ZPYZWMCGVOWBFS-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |