C15H22N4O4 — CID 162387350
tert-butyl N-[(2R)-4-amino-1-(2-aminoanilino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 162387350) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-amino-1-(2-aminoanilino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-amino-1-(2-aminoanilino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 162387350 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | tert-butyl N-[(2R)-4-amino-1-(2-aminoanilino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(N)=O)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C15H22N4O4/c1-15(2,3)23-14(22)19-11(8-12(17)20)13(21)18-10-7-5-4-6-9(10)16/h4-7,11H,8,16H2,1-3H3,(H2,17,20)(H,18,21)(H,19,22)/t11-/m1/s1 |
| InChIKey | BGDIXLQVYPASEX-LLVKDONJSA-N |
| XLogP | 0.98 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|