C16H23N3O5 — CID 126510981
(3R)-4-(5-amino-2-methylanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (PubChem CID 126510981) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3R)-4-(5-amino-2-methylanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid.
| Compound Name | (3R)-4-(5-amino-2-methylanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126510981 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (3R)-4-(5-amino-2-methylanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(N)cc1NC(=O)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23N3O5/c1-9-5-6-10(17)7-11(9)18-14(22)12(8-13(20)21)19-15(23)24-16(2,3)4/h5-7,12H,8,17H2,1-4H3,(H,18,22)(H,19,23)(H,20,21)/t12-/m1/s1 |
| InChIKey | IKIBZXNNYLIECY-GFCCVEGCSA-N |
| XLogP | 1.88 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|