C20H29Cl2N3O5 — CID 126510982
(3R)-4-[5-[bis(2-chloroethyl)amino]-2-methylanilino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (PubChem CID 126510982) has the molecular formula C20H29Cl2N3O5 and a molecular weight of 462.37 g/mol. Its IUPAC name is (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methylanilino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid.
| Compound Name | (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methylanilino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126510982 |
| Molecular Formula | C20H29Cl2N3O5 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methylanilino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(N(CCCl)CCCl)cc1NC(=O)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29Cl2N3O5/c1-13-5-6-14(25(9-7-21)10-8-22)11-15(13)23-18(28)16(12-17(26)27)24-19(29)30-20(2,3)4/h5-6,11,16H,7-10,12H2,1-4H3,(H,23,28)(H,24,29)(H,26,27)/t16-/m1/s1 |
| InChIKey | QRZDWJSHDKCAJV-MRXNPFEDSA-N |
| XLogP | 3.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|