C20H30Br2N2O4 — CID 126511011
(3S)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 126511011) has the molecular formula C20H30Br2N2O4 and a molecular weight of 522.28 g/mol. Its IUPAC name is (3S)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3S)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 126511011 |
| Molecular Formula | C20H30Br2N2O4 |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | (3S)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | Cc1ccc(N(CCBr)CCBr)cc1C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30Br2N2O4/c1-14-5-6-17(24(9-7-21)10-8-22)12-15(14)11-16(13-18(25)26)23-19(27)28-20(2,3)4/h5-6,12,16H,7-11,13H2,1-4H3,(H,23,27)(H,25,26)/t16-/m0/s1 |
| InChIKey | NTNRAIWPHRCXKT-INIZCTEOSA-N |
| XLogP | 4.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|