C20H35BN2O5 — CID 140770917
N-[(2S)-1-[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid (PubChem CID 140770917) has the molecular formula C20H35BN2O5 and a molecular weight of 394.32 g/mol. Its IUPAC name is N-[(2S)-1-[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid.
| Compound Name | N-[(2S)-1-[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 140770917 |
| Molecular Formula | C20H35BN2O5 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[(2S)-1-[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid |
| SMILES | CB(O)N[C@H](CC(=O)OC(C)(C)C)Cc1cc(N(CCO)CCO)ccc1C |
| InChI | InChI=1S/C20H35BN2O5/c1-15-6-7-18(23(8-10-24)9-11-25)13-16(15)12-17(22-21(5)27)14-19(26)28-20(2,3)4/h6-7,13,17,22,24-25,27H,8-12,14H2,1-5H3/t17-/m0/s1 |
| InChIKey | GVBSWWZHNXNAJM-KRWDZBQOSA-N |
| XLogP | 1.13 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|