C16H27BN2O4 — CID 140770764
N-[(2S)-1-(2-amino-5-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid (PubChem CID 140770764) has the molecular formula C16H27BN2O4 and a molecular weight of 322.21 g/mol. Its IUPAC name is N-[(2S)-1-(2-amino-5-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid.
| Compound Name | N-[(2S)-1-(2-amino-5-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 140770764 |
| Molecular Formula | C16H27BN2O4 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[(2S)-1-(2-amino-5-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]-methylboronamidic acid |
| SMILES | COc1ccc(N)c(C[C@@H](CC(=O)OC(C)(C)C)NB(C)O)c1 |
| InChI | InChI=1S/C16H27BN2O4/c1-16(2,3)23-15(20)10-12(19-17(4)21)8-11-9-13(22-5)6-7-14(11)18/h6-7,9,12,19,21H,8,10,18H2,1-5H3/t12-/m0/s1 |
| InChIKey | DKCJUBAUTNTFKQ-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|