C19H31NO3 — CID 132553326
tert-butyl (3R)-3-[(4-methoxyphenyl)methylamino]heptanoate (PubChem CID 132553326) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-methoxyphenyl)methylamino]heptanoate.
| Compound Name | tert-butyl (3R)-3-[(4-methoxyphenyl)methylamino]heptanoate |
|---|---|
| PubChem CID | 132553326 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | tert-butyl (3R)-3-[(4-methoxyphenyl)methylamino]heptanoate |
| SMILES | CCCC[C@H](CC(=O)OC(C)(C)C)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H31NO3/c1-6-7-8-16(13-18(21)23-19(2,3)4)20-14-15-9-11-17(22-5)12-10-15/h9-12,16,20H,6-8,13-14H2,1-5H3/t16-/m1/s1 |
| InChIKey | IMHLEAGVEXOISR-MRXNPFEDSA-N |
| XLogP | 4.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |