C13H21NO2 — CID 111449217
3-[(4-methoxyphenyl)methylamino]pentan-1-ol (PubChem CID 111449217) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylamino]pentan-1-ol.
| Compound Name | 3-[(4-methoxyphenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 111449217 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylamino]pentan-1-ol |
| SMILES | CCC(CCO)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H21NO2/c1-3-12(8-9-15)14-10-11-4-6-13(16-2)7-5-11/h4-7,12,14-15H,3,8-10H2,1-2H3 |
| InChIKey | OLAOTPHYWAWIJI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |