C10H18N2O — CID 115686305
3-(1H-pyrrol-3-ylmethylamino)pentan-1-ol (PubChem CID 115686305) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-(1H-pyrrol-3-ylmethylamino)pentan-1-ol.
| Compound Name | 3-(1H-pyrrol-3-ylmethylamino)pentan-1-ol |
|---|---|
| PubChem CID | 115686305 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-(1H-pyrrol-3-ylmethylamino)pentan-1-ol |
| SMILES | CCC(CCO)NCc1cc[nH]c1 |
| InChI | InChI=1S/C10H18N2O/c1-2-10(4-6-13)12-8-9-3-5-11-7-9/h3,5,7,10-13H,2,4,6,8H2,1H3 |
| InChIKey | AIBLVCDYLGMMDA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |