C12H20N2 — CID 66410514
1-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)butan-2-amine (PubChem CID 66410514) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)butan-2-amine.
| Compound Name | 1-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 66410514 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-cyclopropyl-N-(1H-pyrrol-3-ylmethyl)butan-2-amine |
| SMILES | CCC(CC1CC1)NCc1cc[nH]c1 |
| InChI | InChI=1S/C12H20N2/c1-2-12(7-10-3-4-10)14-9-11-5-6-13-8-11/h5-6,8,10,12-14H,2-4,7,9H2,1H3 |
| InChIKey | IZEHUXGFPUDLHD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |