C16H24BNO5 — CID 123448247
2-[(2R)-2-[[hydroxy(methyl)boranyl]amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]benzoic acid (PubChem CID 123448247) has the molecular formula C16H24BNO5 and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-[(2R)-2-[[hydroxy(methyl)boranyl]amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]benzoic acid.
| Compound Name | 2-[(2R)-2-[[hydroxy(methyl)boranyl]amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]benzoic acid |
|---|---|
| PubChem CID | 123448247 |
| Molecular Formula | C16H24BNO5 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[(2R)-2-[[hydroxy(methyl)boranyl]amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]benzoic acid |
| SMILES | CB(O)N[C@@H](CC(=O)OC(C)(C)C)Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H24BNO5/c1-16(2,3)23-14(19)10-12(18-17(4)22)9-11-7-5-6-8-13(11)15(20)21/h5-8,12,18,22H,9-10H2,1-4H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | MJVZRZWVVDGAHY-GFCCVEGCSA-N |
| XLogP | 1.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|