C15H20N2O5 — CID 18323076
2-[[2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]benzoic acid (PubChem CID 18323076) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[[2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 2-[[2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18323076 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[[2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)CC(N)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,3)22-12(18)8-10(16)13(19)17-11-7-5-4-6-9(11)14(20)21/h4-7,10H,8,16H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | IFVSCRROIAAHDD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |