About 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate
2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate (PubChem CID 159735444) has the molecular formula C13H18ClNO4
and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate.
Molecular Properties
| Compound Name | 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate |
| PubChem CID | 159735444 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate |
| SMILES | CC(C)(C)OC(=O)Cl.NCc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H9NO2.C5H9ClO2/c9-5-6-3-1-2-4-7(6)8(10)11;1-5(2,3)8-4(6)7/h1-4H,5,9H2,(H,10,11);1-3H3 |
| InChIKey | NBTXGCAPVPEAGH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate?
The IUPAC name of 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate (CID 159735444) is 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate.
What is the SMILES notation for 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate?
The canonical SMILES for 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate is CC(C)(C)OC(=O)Cl.NCc1ccccc1C(=O)O.
What is the InChIKey of 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate?
The InChIKey is NBTXGCAPVPEAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C5H9ClO2/c9-5-6-3-1-2-4-7(6)8(10)11;1-5(2,3)8-4(6)7/h1-4H,5,9H2,(H,10,11);1-3H3.
What are the key properties of 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate?
2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate has a molecular weight of 287.74 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)benzoic acid;tert-butyl carbonochloridate is sourced from PubChem (CID 159735444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).