C19H32ClN3O2 — CID 77442200
tert-butyl 3-(4-amino-3-chloroanilino)-4-(pentan-3-ylamino)butanoate (PubChem CID 77442200) has the molecular formula C19H32ClN3O2 and a molecular weight of 369.94 g/mol. Its IUPAC name is tert-butyl 3-(4-amino-3-chloroanilino)-4-(pentan-3-ylamino)butanoate.
| Compound Name | tert-butyl 3-(4-amino-3-chloroanilino)-4-(pentan-3-ylamino)butanoate |
|---|---|
| PubChem CID | 77442200 |
| Molecular Formula | C19H32ClN3O2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | tert-butyl 3-(4-amino-3-chloroanilino)-4-(pentan-3-ylamino)butanoate |
| SMILES | CCC(CC)NCC(CC(=O)OC(C)(C)C)Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C19H32ClN3O2/c1-6-13(7-2)22-12-15(11-18(24)25-19(3,4)5)23-14-8-9-17(21)16(20)10-14/h8-10,13,15,22-23H,6-7,11-12,21H2,1-5H3 |
| InChIKey | OLFRKTZCSPVMAS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|