C21H27ClN4O6S — CID 143629398
tert-butyl (3S)-3-[3-chloro-4-(methylamino)anilino]-4-[(2-nitrophenyl)sulfonylamino]butanoate (PubChem CID 143629398) has the molecular formula C21H27ClN4O6S and a molecular weight of 498.99 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-chloro-4-(methylamino)anilino]-4-[(2-nitrophenyl)sulfonylamino]butanoate.
| Compound Name | tert-butyl (3S)-3-[3-chloro-4-(methylamino)anilino]-4-[(2-nitrophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 143629398 |
| Molecular Formula | C21H27ClN4O6S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | tert-butyl (3S)-3-[3-chloro-4-(methylamino)anilino]-4-[(2-nitrophenyl)sulfonylamino]butanoate |
| SMILES | CNc1ccc(N[C@H](CNS(=O)(=O)c2ccccc2[N+](=O)[O-])CC(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C21H27ClN4O6S/c1-21(2,3)32-20(27)12-15(25-14-9-10-17(23-4)16(22)11-14)13-24-33(30,31)19-8-6-5-7-18(19)26(28)29/h5-11,15,23-25H,12-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | FAFZNENKZBIEAF-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|