C20H25ClN2O3 — CID 158251500
tert-butyl (3R)-3-(2-chlorophenyl)-4-(3,4-diaminophenoxy)butanoate (PubChem CID 158251500) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is tert-butyl (3R)-3-(2-chlorophenyl)-4-(3,4-diaminophenoxy)butanoate.
| Compound Name | tert-butyl (3R)-3-(2-chlorophenyl)-4-(3,4-diaminophenoxy)butanoate |
|---|---|
| PubChem CID | 158251500 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | tert-butyl (3R)-3-(2-chlorophenyl)-4-(3,4-diaminophenoxy)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](COc1ccc(N)c(N)c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O3/c1-20(2,3)26-19(24)10-13(15-6-4-5-7-16(15)21)12-25-14-8-9-17(22)18(23)11-14/h4-9,11,13H,10,12,22-23H2,1-3H3/t13-/m0/s1 |
| InChIKey | GLGQDOMUOTYGAU-ZDUSSCGKSA-N |
| XLogP | 4.40 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|