C19H22ClN3O5 — CID 59362704
tert-butyl N-[(1R)-2-(3-amino-4-nitrophenoxy)-1-(2-chlorophenyl)ethyl]carbamate (PubChem CID 59362704) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-(3-amino-4-nitrophenoxy)-1-(2-chlorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-(3-amino-4-nitrophenoxy)-1-(2-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 59362704 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | tert-butyl N-[(1R)-2-(3-amino-4-nitrophenoxy)-1-(2-chlorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1ccc([N+](=O)[O-])c(N)c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H22ClN3O5/c1-19(2,3)28-18(24)22-16(13-6-4-5-7-14(13)20)11-27-12-8-9-17(23(25)26)15(21)10-12/h4-10,16H,11,21H2,1-3H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | TUYDZXDUUBAGAB-INIZCTEOSA-N |
| XLogP | 4.48 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|