C14H21ClN2O4S — CID 59536886
tert-butyl N-[1-(2-chlorophenyl)-2-(methanesulfonamido)ethyl]carbamate (PubChem CID 59536886) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is tert-butyl N-[1-(2-chlorophenyl)-2-(methanesulfonamido)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-chlorophenyl)-2-(methanesulfonamido)ethyl]carbamate |
|---|---|
| PubChem CID | 59536886 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | tert-butyl N-[1-(2-chlorophenyl)-2-(methanesulfonamido)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNS(C)(=O)=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H21ClN2O4S/c1-14(2,3)21-13(18)17-12(9-16-22(4,19)20)10-7-5-6-8-11(10)15/h5-8,12,16H,9H2,1-4H3,(H,17,18) |
| InChIKey | YVHZGWVWXOPIKG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |