C14H18ClN3O2 — CID 59516277
(3S)-3-(3-chloro-4-cyanoanilino)-4-(propan-2-ylamino)butanoic acid (PubChem CID 59516277) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is (3S)-3-(3-chloro-4-cyanoanilino)-4-(propan-2-ylamino)butanoic acid.
| Compound Name | (3S)-3-(3-chloro-4-cyanoanilino)-4-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 59516277 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (3S)-3-(3-chloro-4-cyanoanilino)-4-(propan-2-ylamino)butanoic acid |
| SMILES | CC(C)NC[C@H](CC(=O)O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-9(2)17-8-12(6-14(19)20)18-11-4-3-10(7-16)13(15)5-11/h3-5,9,12,17-18H,6,8H2,1-2H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | VIZGHUCOOMIYSI-LBPRGKRZSA-N |
| XLogP | 2.46 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |