C15H20ClN3O3 — CID 59516177
methyl (3S)-3-(3-chloro-4-cyanoanilino)-4-(2-methoxyethylamino)butanoate (PubChem CID 59516177) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is methyl (3S)-3-(3-chloro-4-cyanoanilino)-4-(2-methoxyethylamino)butanoate.
| Compound Name | methyl (3S)-3-(3-chloro-4-cyanoanilino)-4-(2-methoxyethylamino)butanoate |
|---|---|
| PubChem CID | 59516177 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl (3S)-3-(3-chloro-4-cyanoanilino)-4-(2-methoxyethylamino)butanoate |
| SMILES | COCCNC[C@H](CC(=O)OC)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-21-6-5-18-10-13(8-15(20)22-2)19-12-4-3-11(9-17)14(16)7-12/h3-4,7,13,18-19H,5-6,8,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | HYNUECDYNPCDSW-ZDUSSCGKSA-N |
| XLogP | 1.79 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|