C24H38Cl2N2O5 — CID 140770866
tert-butyl (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methoxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 140770866) has the molecular formula C24H38Cl2N2O5 and a molecular weight of 505.48 g/mol. Its IUPAC name is tert-butyl (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methoxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methoxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 140770866 |
| Molecular Formula | C24H38Cl2N2O5 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | tert-butyl (3R)-4-[5-[bis(2-chloroethyl)amino]-2-methoxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COc1ccc(N(CCCl)CCCl)cc1C[C@H](CC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38Cl2N2O5/c1-23(2,3)32-21(29)16-18(27-22(30)33-24(4,5)6)14-17-15-19(8-9-20(17)31-7)28(12-10-25)13-11-26/h8-9,15,18H,10-14,16H2,1-7H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | DDYHJOROJGRJST-GOSISDBHSA-N |
| XLogP | 5.15 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|