C22H35ClN2O5 — CID 175091954
(3S)-6-[5-(2-chloroethylamino)-2-methoxyphenyl]-5,5-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 175091954) has the molecular formula C22H35ClN2O5 and a molecular weight of 442.98 g/mol. Its IUPAC name is (3S)-6-[5-(2-chloroethylamino)-2-methoxyphenyl]-5,5-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (3S)-6-[5-(2-chloroethylamino)-2-methoxyphenyl]-5,5-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175091954 |
| Molecular Formula | C22H35ClN2O5 |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (3S)-6-[5-(2-chloroethylamino)-2-methoxyphenyl]-5,5-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COc1ccc(NCCCl)cc1CC(C)(C)C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35ClN2O5/c1-21(2,3)30-20(28)25-17(12-19(26)27)14-22(4,5)13-15-11-16(24-10-9-23)7-8-18(15)29-6/h7-8,11,17,24H,9-10,12-14H2,1-6H3,(H,25,28)(H,26,27)/t17-/m1/s1 |
| InChIKey | SCURXERADNTXBM-QGZVFWFLSA-N |
| XLogP | 4.67 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|