C21H30Cl2N2O5 — CID 126511068
(3S)-4-[5-[bis(2-chloroethyl)carbamoyl]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 126511068) has the molecular formula C21H30Cl2N2O5 and a molecular weight of 461.39 g/mol. Its IUPAC name is (3S)-4-[5-[bis(2-chloroethyl)carbamoyl]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3S)-4-[5-[bis(2-chloroethyl)carbamoyl]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 126511068 |
| Molecular Formula | C21H30Cl2N2O5 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (3S)-4-[5-[bis(2-chloroethyl)carbamoyl]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | Cc1ccc(C(=O)N(CCCl)CCCl)cc1C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30Cl2N2O5/c1-14-5-6-15(19(28)25(9-7-22)10-8-23)11-16(14)12-17(13-18(26)27)24-20(29)30-21(2,3)4/h5-6,11,17H,7-10,12-13H2,1-4H3,(H,24,29)(H,26,27)/t17-/m0/s1 |
| InChIKey | HSYYFHFHJPHGAW-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|