C26H40Cl2N2O6 — CID 175092877
tert-butyl (3S)-4-[5-(3-carbamoyloxy-1,5-dichloropentan-3-yl)-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175092877) has the molecular formula C26H40Cl2N2O6 and a molecular weight of 547.52 g/mol. Its IUPAC name is tert-butyl (3S)-4-[5-(3-carbamoyloxy-1,5-dichloropentan-3-yl)-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (3S)-4-[5-(3-carbamoyloxy-1,5-dichloropentan-3-yl)-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 175092877 |
| Molecular Formula | C26H40Cl2N2O6 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | tert-butyl (3S)-4-[5-(3-carbamoyloxy-1,5-dichloropentan-3-yl)-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | Cc1ccc(C(CCCl)(CCCl)OC(N)=O)cc1C[C@@H](CC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40Cl2N2O6/c1-17-8-9-19(26(10-12-27,11-13-28)35-22(29)32)14-18(17)15-20(16-21(31)34-24(2,3)4)30-23(33)36-25(5,6)7/h8-9,14,20H,10-13,15-16H2,1-7H3,(H2,29,32)(H,30,33)/t20-/m0/s1 |
| InChIKey | BIMDSSXMXAXGQY-FQEVSTJZSA-N |
| XLogP | 5.71 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|