C20H31N3O7 — CID 140770933
tert-butyl (3S)-4-[5-(aminooxymethyl)-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 140770933) has the molecular formula C20H31N3O7 and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl (3S)-4-[5-(aminooxymethyl)-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (3S)-4-[5-(aminooxymethyl)-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 140770933 |
| Molecular Formula | C20H31N3O7 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl (3S)-4-[5-(aminooxymethyl)-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](Cc1cc(CON)ccc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31N3O7/c1-19(2,3)29-17(24)11-15(22-18(25)30-20(4,5)6)10-14-9-13(12-28-21)7-8-16(14)23(26)27/h7-9,15H,10-12,21H2,1-6H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | MFSFIPHAUMCXHN-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|