C23H36N2O6S — CID 102600067
tert-butyl (3S,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)methylsulfanyl]hexanoate (PubChem CID 102600067) has the molecular formula C23H36N2O6S and a molecular weight of 468.62 g/mol. Its IUPAC name is tert-butyl (3S,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)methylsulfanyl]hexanoate.
| Compound Name | tert-butyl (3S,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)methylsulfanyl]hexanoate |
|---|---|
| PubChem CID | 102600067 |
| Molecular Formula | C23H36N2O6S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl (3S,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)methylsulfanyl]hexanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)[C@H](CC(=O)OC(C)(C)C)SCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H36N2O6S/c1-15(2)20(24-21(27)31-23(6,7)8)18(13-19(26)30-22(3,4)5)32-14-16-11-9-10-12-17(16)25(28)29/h9-12,15,18,20H,13-14H2,1-8H3,(H,24,27)/t18-,20-/m0/s1 |
| InChIKey | PKKJUFLSJKULFE-ICSRJNTNSA-N |
| XLogP | 5.48 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|