C28H33N3O9 — CID 140770884
tert-butyl (3S)-4-[5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 140770884) has the molecular formula C28H33N3O9 and a molecular weight of 555.58 g/mol. Its IUPAC name is tert-butyl (3S)-4-[5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl (3S)-4-[5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 140770884 |
| Molecular Formula | C28H33N3O9 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | tert-butyl (3S)-4-[5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2-nitrophenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](Cc1cc(CON2C(=O)c3ccccc3C2=O)ccc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33N3O9/c1-27(2,3)39-23(32)15-19(29-26(35)40-28(4,5)6)14-18-13-17(11-12-22(18)31(36)37)16-38-30-24(33)20-9-7-8-10-21(20)25(30)34/h7-13,19H,14-16H2,1-6H3,(H,29,35)/t19-/m0/s1 |
| InChIKey | DDWXFPWMRZEICI-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|