C22H33N3O13S2-2 — CID 135356571
1-[[3-[(2S)-3-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-4-nitrophenyl]methoxy-(2-sulfinatooxypropyl)amino]propan-2-yl sulfite (PubChem CID 135356571) has the molecular formula C22H33N3O13S2-2 and a molecular weight of 611.65 g/mol. Its IUPAC name is 1-[[3-[(2S)-3-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-4-nitrophenyl]methoxy-(2-sulfinatooxypropyl)amino]propan-2-yl sulfite.
| Compound Name | 1-[[3-[(2S)-3-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-4-nitrophenyl]methoxy-(2-sulfinatooxypropyl)amino]propan-2-yl sulfite |
|---|---|
| PubChem CID | 135356571 |
| Molecular Formula | C22H33N3O13S2-2 |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 1-[[3-[(2S)-3-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-4-nitrophenyl]methoxy-(2-sulfinatooxypropyl)amino]propan-2-yl sulfite |
| SMILES | CC(CN(CC(C)OS(=O)[O-])OCc1ccc([N+](=O)[O-])c(C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C)c1)OS(=O)[O-] |
| InChI | InChI=1S/C22H35N3O13S2/c1-14(37-39(31)32)11-24(12-15(2)38-40(33)34)35-13-16-6-7-19(25(29)30)17(8-16)9-18(10-20(26)27)23-21(28)36-22(3,4)5/h6-8,14-15,18H,9-13H2,1-5H3,(H,23,28)(H,26,27)(H,31,32)(H,33,34)/p-2/t14?,15?,18-/m0/s1 |
| InChIKey | OZOMWIRZKBCCKC-JMLCCBQJSA-L |
| XLogP | 1.64 |
| TPSA | 229.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|