C24H38Cl2N2O4 — CID 175096191
tert-butyl 4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175096191) has the molecular formula C24H38Cl2N2O4 and a molecular weight of 489.48 g/mol. Its IUPAC name is tert-butyl 4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tert-butyl 4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 175096191 |
| Molecular Formula | C24H38Cl2N2O4 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | tert-butyl 4-[5-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | Cc1ccc(N(CCCl)CCCl)cc1CC(CC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38Cl2N2O4/c1-17-8-9-20(28(12-10-25)13-11-26)15-18(17)14-19(16-21(29)31-23(2,3)4)27-22(30)32-24(5,6)7/h8-9,15,19H,10-14,16H2,1-7H3,(H,27,30) |
| InChIKey | NXBFZZKILLUGMZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|