C24H38Br2N2O4 — CID 150129045
butyl (3R)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 150129045) has the molecular formula C24H38Br2N2O4 and a molecular weight of 578.39 g/mol. Its IUPAC name is butyl (3R)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | butyl (3R)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 150129045 |
| Molecular Formula | C24H38Br2N2O4 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | butyl (3R)-4-[5-[bis(2-bromoethyl)amino]-2-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCCCOC(=O)C[C@@H](Cc1cc(N(CCBr)CCBr)ccc1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38Br2N2O4/c1-6-7-14-31-22(29)17-20(27-23(30)32-24(3,4)5)15-19-16-21(9-8-18(19)2)28(12-10-25)13-11-26/h8-9,16,20H,6-7,10-15,17H2,1-5H3,(H,27,30)/t20-/m1/s1 |
| InChIKey | FAVRLEQRZGUKKD-HXUWFJFHSA-N |
| XLogP | 5.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|