C20H26F3NO5 — CID 70302780
butyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoate (PubChem CID 70302780) has the molecular formula C20H26F3NO5 and a molecular weight of 417.42 g/mol. Its IUPAC name is butyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoate.
| Compound Name | butyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoate |
|---|---|
| PubChem CID | 70302780 |
| Molecular Formula | C20H26F3NO5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | butyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoate |
| SMILES | CCCCOC(=O)C[C@@H](CC(=O)c1ccc(F)c(F)c1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26F3NO5/c1-5-6-9-28-16(26)11-12(24-19(27)29-20(2,3)4)10-15(25)13-7-8-14(21)18(23)17(13)22/h7-8,12H,5-6,9-11H2,1-4H3,(H,24,27)/t12-/m1/s1 |
| InChIKey | GLSFZCVYGQZTLV-GFCCVEGCSA-N |
| XLogP | 4.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|