C16H22BrNO4 — CID 104855081
tert-butyl N-[4-(2-bromophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate (PubChem CID 104855081) has the molecular formula C16H22BrNO4 and a molecular weight of 372.26 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 104855081 |
| Molecular Formula | C16H22BrNO4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | tert-butyl N-[4-(2-bromophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate |
| SMILES | COCC(CC(=O)c1ccccc1Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22BrNO4/c1-16(2,3)22-15(20)18-11(10-21-4)9-14(19)12-7-5-6-8-13(12)17/h5-8,11H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | KQOABJNTXGEIAV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |