C16H21ClFNO4 — CID 104855079
tert-butyl N-[4-(3-chloro-4-fluorophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate (PubChem CID 104855079) has the molecular formula C16H21ClFNO4 and a molecular weight of 345.80 g/mol. Its IUPAC name is tert-butyl N-[4-(3-chloro-4-fluorophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(3-chloro-4-fluorophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 104855079 |
| Molecular Formula | C16H21ClFNO4 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | tert-butyl N-[4-(3-chloro-4-fluorophenyl)-1-methoxy-4-oxobutan-2-yl]carbamate |
| SMILES | COCC(CC(=O)c1ccc(F)c(Cl)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21ClFNO4/c1-16(2,3)23-15(21)19-11(9-22-4)8-14(20)10-5-6-13(18)12(17)7-10/h5-7,11H,8-9H2,1-4H3,(H,19,21) |
| InChIKey | MEYDYQRJNNDXCA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |