C16H23NO4 — CID 71508348
tert-butyl N-[(2R)-1-hydroxy-4-(4-methylphenyl)-4-oxobutan-2-yl]carbamate (PubChem CID 71508348) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-hydroxy-4-(4-methylphenyl)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-hydroxy-4-(4-methylphenyl)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71508348 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-hydroxy-4-(4-methylphenyl)-4-oxobutan-2-yl]carbamate |
| SMILES | Cc1ccc(C(=O)C[C@H](CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-11-5-7-12(8-6-11)14(19)9-13(10-18)17-15(20)21-16(2,3)4/h5-8,13,18H,9-10H2,1-4H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | MXBMLOKYXVALGJ-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |