C17H23NO5 — CID 15234707
methyl (2S)-4-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 15234707) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl (2S)-4-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | methyl (2S)-4-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 15234707 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl (2S)-4-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](CC(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO5/c1-11-6-8-12(9-7-11)14(19)10-13(15(20)22-5)18-16(21)23-17(2,3)4/h6-9,13H,10H2,1-5H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | PTMOQAGVUDJWKK-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |