C13H19NO4S — CID 71508403
tert-butyl N-[(2R)-1-hydroxy-4-oxo-4-thiophen-2-ylbutan-2-yl]carbamate (PubChem CID 71508403) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-hydroxy-4-oxo-4-thiophen-2-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-hydroxy-4-oxo-4-thiophen-2-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71508403 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl N-[(2R)-1-hydroxy-4-oxo-4-thiophen-2-ylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)CC(=O)c1cccs1 |
| InChI | InChI=1S/C13H19NO4S/c1-13(2,3)18-12(17)14-9(8-15)7-10(16)11-5-4-6-19-11/h4-6,9,15H,7-8H2,1-3H3,(H,14,17)/t9-/m1/s1 |
| InChIKey | KJWUODJSPGWXBD-SECBINFHSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |