C16H24N2O4 — CID 104856519
tert-butyl N-(5-methoxy-1-oxo-1-pyridin-4-ylpentan-3-yl)carbamate (PubChem CID 104856519) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl N-(5-methoxy-1-oxo-1-pyridin-4-ylpentan-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-methoxy-1-oxo-1-pyridin-4-ylpentan-3-yl)carbamate |
|---|---|
| PubChem CID | 104856519 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | tert-butyl N-(5-methoxy-1-oxo-1-pyridin-4-ylpentan-3-yl)carbamate |
| SMILES | COCCC(CC(=O)c1ccncc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O4/c1-16(2,3)22-15(20)18-13(7-10-21-4)11-14(19)12-5-8-17-9-6-12/h5-6,8-9,13H,7,10-11H2,1-4H3,(H,18,20) |
| InChIKey | XLHVJOYTDFXPCR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |