C16H23FN2O4 — CID 104855208
tert-butyl N-[1-(5-fluoro-2-pyridinyl)-5-methoxy-1-oxopentan-3-yl]carbamate (PubChem CID 104855208) has the molecular formula C16H23FN2O4 and a molecular weight of 326.37 g/mol. Its IUPAC name is tert-butyl N-[1-(5-fluoro-2-pyridinyl)-5-methoxy-1-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-fluoro-2-pyridinyl)-5-methoxy-1-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 104855208 |
| Molecular Formula | C16H23FN2O4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl N-[1-(5-fluoro-2-pyridinyl)-5-methoxy-1-oxopentan-3-yl]carbamate |
| SMILES | COCCC(CC(=O)c1ccc(F)cn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23FN2O4/c1-16(2,3)23-15(21)19-12(7-8-22-4)9-14(20)13-6-5-11(17)10-18-13/h5-6,10,12H,7-9H2,1-4H3,(H,19,21) |
| InChIKey | AERIBWSJTXFDJD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |