C15H22BrNO4S — CID 104856528
tert-butyl N-[1-(5-bromothiophen-2-yl)-5-methoxy-1-oxopentan-3-yl]carbamate (PubChem CID 104856528) has the molecular formula C15H22BrNO4S and a molecular weight of 392.32 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromothiophen-2-yl)-5-methoxy-1-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromothiophen-2-yl)-5-methoxy-1-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 104856528 |
| Molecular Formula | C15H22BrNO4S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | tert-butyl N-[1-(5-bromothiophen-2-yl)-5-methoxy-1-oxopentan-3-yl]carbamate |
| SMILES | COCCC(CC(=O)c1ccc(Br)s1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22BrNO4S/c1-15(2,3)21-14(19)17-10(7-8-20-4)9-11(18)12-5-6-13(16)22-12/h5-6,10H,7-9H2,1-4H3,(H,17,19) |
| InChIKey | QQIUEIOHBHYPJS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |