C17H24FNO4 — CID 104855146
tert-butyl N-[1-(3-fluorophenyl)-5-methoxy-1-oxopentan-3-yl]carbamate (PubChem CID 104855146) has the molecular formula C17H24FNO4 and a molecular weight of 325.38 g/mol. Its IUPAC name is tert-butyl N-[1-(3-fluorophenyl)-5-methoxy-1-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-fluorophenyl)-5-methoxy-1-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 104855146 |
| Molecular Formula | C17H24FNO4 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl N-[1-(3-fluorophenyl)-5-methoxy-1-oxopentan-3-yl]carbamate |
| SMILES | COCCC(CC(=O)c1cccc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24FNO4/c1-17(2,3)23-16(21)19-14(8-9-22-4)11-15(20)12-6-5-7-13(18)10-12/h5-7,10,14H,8-9,11H2,1-4H3,(H,19,21) |
| InChIKey | LBCTZZGUIRTUMZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |