C17H23NO5 — CID 138487610
(2R)-5-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 138487610) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is (2R)-5-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138487610 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2R)-5-(3-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | Cc1cccc(C(=O)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO5/c1-11-6-5-7-12(10-11)14(19)9-8-13(15(20)21)18-16(22)23-17(2,3)4/h5-7,10,13H,8-9H2,1-4H3,(H,18,22)(H,20,21)/t13-/m1/s1 |
| InChIKey | JVQNIGRWXHVBSR-CYBMUJFWSA-N |
| XLogP | 2.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |