C16H18F3NO5 — CID 69073693
2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoic acid (PubChem CID 69073693) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 69073693 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trifluorophenyl)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C16H18F3NO5/c1-16(2,3)25-15(24)20-10(14(22)23)6-7-11(21)8-4-5-9(17)13(19)12(8)18/h4-5,10H,6-7H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | XHUSYQYVTUKXLL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|