C16H20ClNO5 — CID 69069316
5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 69069316) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 69069316 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H20ClNO5/c1-16(2,3)23-15(22)18-12(14(20)21)8-9-13(19)10-4-6-11(17)7-5-10/h4-7,12H,8-9H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | DXPQYRUHXCITFW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |