C16H21F2NO4 — CID 104855076
tert-butyl N-[4-[3-(difluoromethoxy)phenyl]-4-oxobutan-2-yl]carbamate (PubChem CID 104855076) has the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(difluoromethoxy)phenyl]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(difluoromethoxy)phenyl]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 104855076 |
| Molecular Formula | C16H21F2NO4 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | tert-butyl N-[4-[3-(difluoromethoxy)phenyl]-4-oxobutan-2-yl]carbamate |
| SMILES | CC(CC(=O)c1cccc(OC(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21F2NO4/c1-10(19-15(21)23-16(2,3)4)8-13(20)11-6-5-7-12(9-11)22-14(17)18/h5-7,9-10,14H,8H2,1-4H3,(H,19,21) |
| InChIKey | HWAZQGGYGPLTDV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |