C13H14ClFO2 — CID 28896606
1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentane-1,3-dione (PubChem CID 28896606) has the molecular formula C13H14ClFO2 and a molecular weight of 256.70 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 28896606 |
| Molecular Formula | C13H14ClFO2 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentane-1,3-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClFO2/c1-13(2,3)12(17)7-11(16)8-4-5-10(15)9(14)6-8/h4-6H,7H2,1-3H3 |
| InChIKey | DHUJSHVMILYANS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|