C12H15ClFNO — CID 116916367
4-amino-1-(3-chloro-4-fluorophenyl)-2,2-dimethylbutan-1-one (PubChem CID 116916367) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is 4-amino-1-(3-chloro-4-fluorophenyl)-2,2-dimethylbutan-1-one.
| Compound Name | 4-amino-1-(3-chloro-4-fluorophenyl)-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 116916367 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-amino-1-(3-chloro-4-fluorophenyl)-2,2-dimethylbutan-1-one |
| SMILES | CC(C)(CCN)C(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO/c1-12(2,5-6-15)11(16)8-3-4-10(14)9(13)7-8/h3-4,7H,5-6,15H2,1-2H3 |
| InChIKey | NJGLZAPBUASJFB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |