C14H10ClFO3 — CID 43321403
1-(3-chloro-4-fluorophenyl)-3-(2-methylfuran-3-yl)propane-1,3-dione (PubChem CID 43321403) has the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(2-methylfuran-3-yl)propane-1,3-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(2-methylfuran-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 43321403 |
| Molecular Formula | C14H10ClFO3 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(2-methylfuran-3-yl)propane-1,3-dione |
| SMILES | Cc1occc1C(=O)CC(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFO3/c1-8-10(4-5-19-8)14(18)7-13(17)9-2-3-12(16)11(15)6-9/h2-6H,7H2,1H3 |
| InChIKey | KNMTXPFJEWRTKA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|