C13H13Cl2FO2 — CID 60929252
1-(2,4-dichloro-5-fluorophenyl)-4,4-dimethylpentane-1,3-dione (PubChem CID 60929252) has the molecular formula C13H13Cl2FO2 and a molecular weight of 291.15 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 60929252 |
| Molecular Formula | C13H13Cl2FO2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-4,4-dimethylpentane-1,3-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2FO2/c1-13(2,3)12(18)6-11(17)7-4-10(16)9(15)5-8(7)14/h4-5H,6H2,1-3H3 |
| InChIKey | OOJFBUBTWWZCCD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|