C11H14Cl3FN2O — CID 119521536
N-(1-amino-2-methylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide;hydrochloride (PubChem CID 119521536) has the molecular formula C11H14Cl3FN2O and a molecular weight of 315.60 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119521536 |
| Molecular Formula | C11H14Cl3FN2O |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2,4-dichloro-5-fluorobenzamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)c1cc(F)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C11H13Cl2FN2O.ClH/c1-11(2,5-15)16-10(17)6-3-9(14)8(13)4-7(6)12;/h3-4H,5,15H2,1-2H3,(H,16,17);1H |
| InChIKey | VRKXHZLDNQGRTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|